C10H11Cl2NO — CID 63331897
N-(2,3-dichlorophenyl)oxolan-3-amine (PubChem CID 63331897) has the molecular formula C10H11Cl2NO and a molecular weight of 232.11 g/mol. Its IUPAC name is N-(2,3-dichlorophenyl)oxolan-3-amine.
| Compound Name | N-(2,3-dichlorophenyl)oxolan-3-amine |
|---|---|
| PubChem CID | 63331897 |
| Molecular Formula | C10H11Cl2NO |
| Molecular Weight | 232.11 g/mol |
| Exact Mass | 231.02 |
| IUPAC Name | N-(2,3-dichlorophenyl)oxolan-3-amine |
| SMILES | Clc1cccc(NC2CCOC2)c1Cl |
| InChI | InChI=1S/C10H11Cl2NO/c11-8-2-1-3-9(10(8)12)13-7-4-5-14-6-7/h1-3,7,13H,4-6H2 |
| InChIKey | IZJLYZXNNYKKDV-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.11 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |