C16H26N2 — CID 43726463
1-N-cyclooctyl-2-N,2-N-dimethylbenzene-1,2-diamine (PubChem CID 43726463) has the molecular formula C16H26N2 and a molecular weight of 246.40 g/mol. Its IUPAC name is 1-N-cyclooctyl-2-N,2-N-dimethylbenzene-1,2-diamine.
| Compound Name | 1-N-cyclooctyl-2-N,2-N-dimethylbenzene-1,2-diamine |
|---|---|
| PubChem CID | 43726463 |
| Molecular Formula | C16H26N2 |
| Molecular Weight | 246.40 g/mol |
| Exact Mass | 246.21 |
| IUPAC Name | 1-N-cyclooctyl-2-N,2-N-dimethylbenzene-1,2-diamine |
| SMILES | CN(C)c1ccccc1NC1CCCCCCC1 |
| InChI | InChI=1S/C16H26N2/c1-18(2)16-13-9-8-12-15(16)17-14-10-6-4-3-5-7-11-14/h8-9,12-14,17H,3-7,10-11H2,1-2H3 |
| InChIKey | RXUIWNFFFVQQIX-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.40 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |