C16H25ClN2 — CID 43741067
4-chloro-2-N-cyclooctyl-1-N,1-N-dimethylbenzene-1,2-diamine (PubChem CID 43741067) has the molecular formula C16H25ClN2 and a molecular weight of 280.84 g/mol. Its IUPAC name is 4-chloro-2-N-cyclooctyl-1-N,1-N-dimethylbenzene-1,2-diamine.
| Compound Name | 4-chloro-2-N-cyclooctyl-1-N,1-N-dimethylbenzene-1,2-diamine |
|---|---|
| PubChem CID | 43741067 |
| Molecular Formula | C16H25ClN2 |
| Molecular Weight | 280.84 g/mol |
| Exact Mass | 280.17 |
| IUPAC Name | 4-chloro-2-N-cyclooctyl-1-N,1-N-dimethylbenzene-1,2-diamine |
| SMILES | CN(C)c1ccc(Cl)cc1NC1CCCCCCC1 |
| InChI | InChI=1S/C16H25ClN2/c1-19(2)16-11-10-13(17)12-15(16)18-14-8-6-4-3-5-7-9-14/h10-12,14,18H,3-9H2,1-2H3 |
| InChIKey | CBBOCAHZWQDXAX-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.84 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |