C17H16N4O — CID 168608105
2-(2-cyclohexyloxyanilino)ethene-1,1,2-tricarbonitrile (PubChem CID 168608105) has the molecular formula C17H16N4O and a molecular weight of 292.34 g/mol. Its IUPAC name is 2-(2-cyclohexyloxyanilino)ethene-1,1,2-tricarbonitrile.
| Compound Name | 2-(2-cyclohexyloxyanilino)ethene-1,1,2-tricarbonitrile |
|---|---|
| PubChem CID | 168608105 |
| Molecular Formula | C17H16N4O |
| Molecular Weight | 292.34 g/mol |
| Exact Mass | 292.13 |
| IUPAC Name | 2-(2-cyclohexyloxyanilino)ethene-1,1,2-tricarbonitrile |
| SMILES | N#CC(C#N)=C(C#N)Nc1ccccc1OC1CCCCC1 |
| InChI | InChI=1S/C17H16N4O/c18-10-13(11-19)16(12-20)21-15-8-4-5-9-17(15)22-14-6-2-1-3-7-14/h4-5,8-9,14,21H,1-3,6-7H2 |
| InChIKey | MSSSBJUWYXMCHN-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 92.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.34 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|