C20H31N3O2 — CID 125138727
(4S)-N-(2-cyclopentyloxyphenyl)-4-(dimethylamino)azepane-1-carboxamide (PubChem CID 125138727) has the molecular formula C20H31N3O2 and a molecular weight of 345.49 g/mol. Its IUPAC name is (4S)-N-(2-cyclopentyloxyphenyl)-4-(dimethylamino)azepane-1-carboxamide.
| Compound Name | (4S)-N-(2-cyclopentyloxyphenyl)-4-(dimethylamino)azepane-1-carboxamide |
|---|---|
| PubChem CID | 125138727 |
| Molecular Formula | C20H31N3O2 |
| Molecular Weight | 345.49 g/mol |
| Exact Mass | 345.24 |
| IUPAC Name | (4S)-N-(2-cyclopentyloxyphenyl)-4-(dimethylamino)azepane-1-carboxamide |
| SMILES | CN(C)[C@H]1CCCN(C(=O)Nc2ccccc2OC2CCCC2)CC1 |
| InChI | InChI=1S/C20H31N3O2/c1-22(2)16-8-7-14-23(15-13-16)20(24)21-18-11-5-6-12-19(18)25-17-9-3-4-10-17/h5-6,11-12,16-17H,3-4,7-10,13-15H2,1-2H3,(H,21,24)/t16-/m0/s1 |
| InChIKey | XXVMZQWXIBNFAZ-INIZCTEOSA-N |
| XLogP | 3.96 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.49 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |