C13H10N4O2 — CID 168607208
2-[2-(methoxymethoxy)anilino]ethene-1,1,2-tricarbonitrile (PubChem CID 168607208) has the molecular formula C13H10N4O2 and a molecular weight of 254.25 g/mol. Its IUPAC name is 2-[2-(methoxymethoxy)anilino]ethene-1,1,2-tricarbonitrile.
| Compound Name | 2-[2-(methoxymethoxy)anilino]ethene-1,1,2-tricarbonitrile |
|---|---|
| PubChem CID | 168607208 |
| Molecular Formula | C13H10N4O2 |
| Molecular Weight | 254.25 g/mol |
| Exact Mass | 254.08 |
| IUPAC Name | 2-[2-(methoxymethoxy)anilino]ethene-1,1,2-tricarbonitrile |
| SMILES | COCOc1ccccc1NC(C#N)=C(C#N)C#N |
| InChI | InChI=1S/C13H10N4O2/c1-18-9-19-13-5-3-2-4-11(13)17-12(8-16)10(6-14)7-15/h2-5,17H,9H2,1H3 |
| InChIKey | NYMSZNQAZDTOSJ-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 101.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.25 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|