About 2-[(2-cyclohexyl-1-oxo-3H-isoindol-4-yl)amino]ethene-1,1,2-tricarbonitrile
2-[(2-cyclohexyl-1-oxo-3H-isoindol-4-yl)amino]ethene-1,1,2-tricarbonitrile (PubChem CID 168607913) has the molecular formula C19H17N5O
and a molecular weight of 331.38 g/mol. Its IUPAC name is 2-[(2-cyclohexyl-1-oxo-3H-isoindol-4-yl)amino]ethene-1,1,2-tricarbonitrile.
Molecular Properties
| Compound Name | 2-[(2-cyclohexyl-1-oxo-3H-isoindol-4-yl)amino]ethene-1,1,2-tricarbonitrile |
| PubChem CID | 168607913 |
| Molecular Formula | C19H17N5O |
| Molecular Weight | 331.38 g/mol |
| Exact Mass | 331.14 |
| IUPAC Name | 2-[(2-cyclohexyl-1-oxo-3H-isoindol-4-yl)amino]ethene-1,1,2-tricarbonitrile |
| SMILES | N#CC(C#N)=C(C#N)Nc1cccc2c1CN(C1CCCCC1)C2=O |
| InChI | InChI=1S/C19H17N5O/c20-9-13(10-21)18(11-22)23-17-8-4-7-15-16(17)12-24(19(15)25)14-5-2-1-3-6-14/h4,7-8,14,23H,1-3,5-6,12H2 |
| InChIKey | VWWNDGOGNAJJDA-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 103.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.38 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|
Analyze 2-[(2-cyclohexyl-1-oxo-3H-isoindol-4-yl)amino]ethene-1,1,2-tricarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2-cyclohexyl-1-oxo-3H-isoindol-4-yl)amino]ethene-1,1,2-tricarbonitrile?
The IUPAC name of 2-[(2-cyclohexyl-1-oxo-3H-isoindol-4-yl)amino]ethene-1,1,2-tricarbonitrile (CID 168607913) is 2-[(2-cyclohexyl-1-oxo-3H-isoindol-4-yl)amino]ethene-1,1,2-tricarbonitrile.
What is the SMILES notation for 2-[(2-cyclohexyl-1-oxo-3H-isoindol-4-yl)amino]ethene-1,1,2-tricarbonitrile?
The canonical SMILES for 2-[(2-cyclohexyl-1-oxo-3H-isoindol-4-yl)amino]ethene-1,1,2-tricarbonitrile is N#CC(C#N)=C(C#N)Nc1cccc2c1CN(C1CCCCC1)C2=O.
What is the InChIKey of 2-[(2-cyclohexyl-1-oxo-3H-isoindol-4-yl)amino]ethene-1,1,2-tricarbonitrile?
The InChIKey is VWWNDGOGNAJJDA-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H17N5O/c20-9-13(10-21)18(11-22)23-17-8-4-7-15-16(17)12-24(19(15)25)14-5-2-1-3-6-14/h4,7-8,14,23H,1-3,5-6,12H2.
What are the key properties of 2-[(2-cyclohexyl-1-oxo-3H-isoindol-4-yl)amino]ethene-1,1,2-tricarbonitrile?
2-[(2-cyclohexyl-1-oxo-3H-isoindol-4-yl)amino]ethene-1,1,2-tricarbonitrile has a molecular weight of 331.38 g/mol, XLogP of 3.21, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2-cyclohexyl-1-oxo-3H-isoindol-4-yl)amino]ethene-1,1,2-tricarbonitrile is sourced from PubChem (CID 168607913), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).