C17H19NO4 — CID 22385719
(2-cyclopentyl-1-oxo-3H-isoindol-4-yl) 2-oxobutanoate (PubChem CID 22385719) has the molecular formula C17H19NO4 and a molecular weight of 301.34 g/mol. Its IUPAC name is (2-cyclopentyl-1-oxo-3H-isoindol-4-yl) 2-oxobutanoate.
| Compound Name | (2-cyclopentyl-1-oxo-3H-isoindol-4-yl) 2-oxobutanoate |
|---|---|
| PubChem CID | 22385719 |
| Molecular Formula | C17H19NO4 |
| Molecular Weight | 301.34 g/mol |
| Exact Mass | 301.13 |
| IUPAC Name | (2-cyclopentyl-1-oxo-3H-isoindol-4-yl) 2-oxobutanoate |
| SMILES | CCC(=O)C(=O)Oc1cccc2c1CN(C1CCCC1)C2=O |
| InChI | InChI=1S/C17H19NO4/c1-2-14(19)17(21)22-15-9-5-8-12-13(15)10-18(16(12)20)11-6-3-4-7-11/h5,8-9,11H,2-4,6-7,10H2,1H3 |
| InChIKey | WFGZYSUQWQQPNJ-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.34 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|