C21H27NO4 — CID 123173778
5-(7-hexoxy-3-oxo-1H-isoindol-2-yl)cycloheptane-1,4-dione (PubChem CID 123173778) has the molecular formula C21H27NO4 and a molecular weight of 357.45 g/mol. Its IUPAC name is 5-(7-hexoxy-3-oxo-1H-isoindol-2-yl)cycloheptane-1,4-dione.
| Compound Name | 5-(7-hexoxy-3-oxo-1H-isoindol-2-yl)cycloheptane-1,4-dione |
|---|---|
| PubChem CID | 123173778 |
| Molecular Formula | C21H27NO4 |
| Molecular Weight | 357.45 g/mol |
| Exact Mass | 357.19 |
| IUPAC Name | 5-(7-hexoxy-3-oxo-1H-isoindol-2-yl)cycloheptane-1,4-dione |
| SMILES | CCCCCCOc1cccc2c1CN(C1CCC(=O)CCC1=O)C2=O |
| InChI | InChI=1S/C21H27NO4/c1-2-3-4-5-13-26-20-8-6-7-16-17(20)14-22(21(16)25)18-11-9-15(23)10-12-19(18)24/h6-8,18H,2-5,9-14H2,1H3 |
| InChIKey | LKJPMSSGVJPHHZ-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.45 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|