C20H23NO5 — CID 4529184
[2-[(1-cyclohexyl-4,5-dioxopyrrolidin-3-ylidene)methyl]phenyl] ethyl carbonate (PubChem CID 4529184) has the molecular formula C20H23NO5 and a molecular weight of 357.41 g/mol. Its IUPAC name is [2-[(1-cyclohexyl-4,5-dioxopyrrolidin-3-ylidene)methyl]phenyl] ethyl carbonate.
| Compound Name | [2-[(1-cyclohexyl-4,5-dioxopyrrolidin-3-ylidene)methyl]phenyl] ethyl carbonate |
|---|---|
| PubChem CID | 4529184 |
| Molecular Formula | C20H23NO5 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.16 |
| IUPAC Name | [2-[(1-cyclohexyl-4,5-dioxopyrrolidin-3-ylidene)methyl]phenyl] ethyl carbonate |
| SMILES | CCOC(=O)Oc1ccccc1C=C1CN(C2CCCCC2)C(=O)C1=O |
| InChI | InChI=1S/C20H23NO5/c1-2-25-20(24)26-17-11-7-6-8-14(17)12-15-13-21(19(23)18(15)22)16-9-4-3-5-10-16/h6-8,11-12,16H,2-5,9-10,13H2,1H3 |
| InChIKey | YBFKCVJUAORGBR-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|