About [2-[(1-cyclohexyl-4,5-dioxopyrrolidin-3-ylidene)methyl]phenyl] ethyl carbonate
[2-[(1-cyclohexyl-4,5-dioxopyrrolidin-3-ylidene)methyl]phenyl] ethyl carbonate (PubChem CID 4529184) has the molecular formula C20H23NO5
and a molecular weight of 357.41 g/mol. Its IUPAC name is [2-[(1-cyclohexyl-4,5-dioxopyrrolidin-3-ylidene)methyl]phenyl] ethyl carbonate.
Molecular Properties
| Compound Name | [2-[(1-cyclohexyl-4,5-dioxopyrrolidin-3-ylidene)methyl]phenyl] ethyl carbonate |
| PubChem CID | 4529184 |
| Molecular Formula | C20H23NO5 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.16 |
| IUPAC Name | [2-[(1-cyclohexyl-4,5-dioxopyrrolidin-3-ylidene)methyl]phenyl] ethyl carbonate |
| SMILES | CCOC(=O)Oc1ccccc1C=C1CN(C2CCCCC2)C(=O)C1=O |
| InChI | InChI=1S/C20H23NO5/c1-2-25-20(24)26-17-11-7-6-8-14(17)12-15-13-21(19(23)18(15)22)16-9-4-3-5-10-16/h6-8,11-12,16H,2-5,9-10,13H2,1H3 |
| InChIKey | YBFKCVJUAORGBR-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|
Analyze [2-[(1-cyclohexyl-4,5-dioxopyrrolidin-3-ylidene)methyl]phenyl] ethyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[(1-cyclohexyl-4,5-dioxopyrrolidin-3-ylidene)methyl]phenyl] ethyl carbonate?
The IUPAC name of [2-[(1-cyclohexyl-4,5-dioxopyrrolidin-3-ylidene)methyl]phenyl] ethyl carbonate (CID 4529184) is [2-[(1-cyclohexyl-4,5-dioxopyrrolidin-3-ylidene)methyl]phenyl] ethyl carbonate.
What is the SMILES notation for [2-[(1-cyclohexyl-4,5-dioxopyrrolidin-3-ylidene)methyl]phenyl] ethyl carbonate?
The canonical SMILES for [2-[(1-cyclohexyl-4,5-dioxopyrrolidin-3-ylidene)methyl]phenyl] ethyl carbonate is CCOC(=O)Oc1ccccc1C=C1CN(C2CCCCC2)C(=O)C1=O.
What is the InChIKey of [2-[(1-cyclohexyl-4,5-dioxopyrrolidin-3-ylidene)methyl]phenyl] ethyl carbonate?
The InChIKey is YBFKCVJUAORGBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H23NO5/c1-2-25-20(24)26-17-11-7-6-8-14(17)12-15-13-21(19(23)18(15)22)16-9-4-3-5-10-16/h6-8,11-12,16H,2-5,9-10,13H2,1H3.
What are the key properties of [2-[(1-cyclohexyl-4,5-dioxopyrrolidin-3-ylidene)methyl]phenyl] ethyl carbonate?
[2-[(1-cyclohexyl-4,5-dioxopyrrolidin-3-ylidene)methyl]phenyl] ethyl carbonate has a molecular weight of 357.41 g/mol, XLogP of 3.35, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[(1-cyclohexyl-4,5-dioxopyrrolidin-3-ylidene)methyl]phenyl] ethyl carbonate is sourced from PubChem (CID 4529184), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).