C31H29N3O7 — CID 108930967
[4-[[2-[(2-cyclohexyl-1,3-dioxoisoindole-5-carbonyl)amino]phenyl]carbamoyl]phenyl] ethyl carbonate (PubChem CID 108930967) has the molecular formula C31H29N3O7 and a molecular weight of 555.59 g/mol. Its IUPAC name is [4-[[2-[(2-cyclohexyl-1,3-dioxoisoindole-5-carbonyl)amino]phenyl]carbamoyl]phenyl] ethyl carbonate.
| Compound Name | [4-[[2-[(2-cyclohexyl-1,3-dioxoisoindole-5-carbonyl)amino]phenyl]carbamoyl]phenyl] ethyl carbonate |
|---|---|
| PubChem CID | 108930967 |
| Molecular Formula | C31H29N3O7 |
| Molecular Weight | 555.59 g/mol |
| Exact Mass | 555.20 |
| IUPAC Name | [4-[[2-[(2-cyclohexyl-1,3-dioxoisoindole-5-carbonyl)amino]phenyl]carbamoyl]phenyl] ethyl carbonate |
| SMILES | CCOC(=O)Oc1ccc(C(=O)Nc2ccccc2NC(=O)c2ccc3c(c2)C(=O)N(C2CCCCC2)C3=O)cc1 |
| InChI | InChI=1S/C31H29N3O7/c1-2-40-31(39)41-22-15-12-19(13-16-22)27(35)32-25-10-6-7-11-26(25)33-28(36)20-14-17-23-24(18-20)30(38)34(29(23)37)21-8-4-3-5-9-21/h6-7,10-18,21H,2-5,8-9H2,1H3,(H,32,35)(H,33,36) |
| InChIKey | DYWDAWZGUGHYGK-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 131.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.59 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|