C30H33N3O7 — CID 108929659
[4-[4-(2-cyclohexyl-1,3-dioxoisoindole-5-carbonyl)-1,4-diazepane-1-carbonyl]phenyl] ethyl carbonate (PubChem CID 108929659) has the molecular formula C30H33N3O7 and a molecular weight of 547.61 g/mol. Its IUPAC name is [4-[4-(2-cyclohexyl-1,3-dioxoisoindole-5-carbonyl)-1,4-diazepane-1-carbonyl]phenyl] ethyl carbonate.
| Compound Name | [4-[4-(2-cyclohexyl-1,3-dioxoisoindole-5-carbonyl)-1,4-diazepane-1-carbonyl]phenyl] ethyl carbonate |
|---|---|
| PubChem CID | 108929659 |
| Molecular Formula | C30H33N3O7 |
| Molecular Weight | 547.61 g/mol |
| Exact Mass | 547.23 |
| IUPAC Name | [4-[4-(2-cyclohexyl-1,3-dioxoisoindole-5-carbonyl)-1,4-diazepane-1-carbonyl]phenyl] ethyl carbonate |
| SMILES | CCOC(=O)Oc1ccc(C(=O)N2CCCN(C(=O)c3ccc4c(c3)C(=O)N(C3CCCCC3)C4=O)CC2)cc1 |
| InChI | InChI=1S/C30H33N3O7/c1-2-39-30(38)40-23-12-9-20(10-13-23)26(34)31-15-6-16-32(18-17-31)27(35)21-11-14-24-25(19-21)29(37)33(28(24)36)22-7-4-3-5-8-22/h9-14,19,22H,2-8,15-18H2,1H3 |
| InChIKey | LFDLONXLZYLMNJ-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 113.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.61 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|