C28H31N3O7 — CID 108929657
[4-[4-(2-tert-butyl-1,3-dioxoisoindole-5-carbonyl)-1,4-diazepane-1-carbonyl]phenyl] ethyl carbonate (PubChem CID 108929657) has the molecular formula C28H31N3O7 and a molecular weight of 521.57 g/mol. Its IUPAC name is [4-[4-(2-tert-butyl-1,3-dioxoisoindole-5-carbonyl)-1,4-diazepane-1-carbonyl]phenyl] ethyl carbonate.
| Compound Name | [4-[4-(2-tert-butyl-1,3-dioxoisoindole-5-carbonyl)-1,4-diazepane-1-carbonyl]phenyl] ethyl carbonate |
|---|---|
| PubChem CID | 108929657 |
| Molecular Formula | C28H31N3O7 |
| Molecular Weight | 521.57 g/mol |
| Exact Mass | 521.22 |
| IUPAC Name | [4-[4-(2-tert-butyl-1,3-dioxoisoindole-5-carbonyl)-1,4-diazepane-1-carbonyl]phenyl] ethyl carbonate |
| SMILES | CCOC(=O)Oc1ccc(C(=O)N2CCCN(C(=O)c3ccc4c(c3)C(=O)N(C(C)(C)C)C4=O)CC2)cc1 |
| InChI | InChI=1S/C28H31N3O7/c1-5-37-27(36)38-20-10-7-18(8-11-20)23(32)29-13-6-14-30(16-15-29)24(33)19-9-12-21-22(17-19)26(35)31(25(21)34)28(2,3)4/h7-12,17H,5-6,13-16H2,1-4H3 |
| InChIKey | VANJSKTVLYWDFI-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 113.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.57 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|