C23H25N3O4S — CID 108545907
2-tert-butyl-5-[4-(thiophene-2-carbonyl)-1,4-diazepane-1-carbonyl]isoindole-1,3-dione (PubChem CID 108545907) has the molecular formula C23H25N3O4S and a molecular weight of 439.54 g/mol. Its IUPAC name is 2-tert-butyl-5-[4-(thiophene-2-carbonyl)-1,4-diazepane-1-carbonyl]isoindole-1,3-dione.
| Compound Name | 2-tert-butyl-5-[4-(thiophene-2-carbonyl)-1,4-diazepane-1-carbonyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 108545907 |
| Molecular Formula | C23H25N3O4S |
| Molecular Weight | 439.54 g/mol |
| Exact Mass | 439.16 |
| IUPAC Name | 2-tert-butyl-5-[4-(thiophene-2-carbonyl)-1,4-diazepane-1-carbonyl]isoindole-1,3-dione |
| SMILES | CC(C)(C)N1C(=O)c2ccc(C(=O)N3CCCN(C(=O)c4cccs4)CC3)cc2C1=O |
| InChI | InChI=1S/C23H25N3O4S/c1-23(2,3)26-20(28)16-8-7-15(14-17(16)21(26)29)19(27)24-9-5-10-25(12-11-24)22(30)18-6-4-13-31-18/h4,6-8,13-14H,5,9-12H2,1-3H3 |
| InChIKey | XTNBZEBFGFQQLO-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 78.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.54 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|