C25H27N3O4 — CID 108534722
2-tert-butyl-5-[4-(2-phenylacetyl)piperazine-1-carbonyl]isoindole-1,3-dione (PubChem CID 108534722) has the molecular formula C25H27N3O4 and a molecular weight of 433.51 g/mol. Its IUPAC name is 2-tert-butyl-5-[4-(2-phenylacetyl)piperazine-1-carbonyl]isoindole-1,3-dione.
| Compound Name | 2-tert-butyl-5-[4-(2-phenylacetyl)piperazine-1-carbonyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 108534722 |
| Molecular Formula | C25H27N3O4 |
| Molecular Weight | 433.51 g/mol |
| Exact Mass | 433.20 |
| IUPAC Name | 2-tert-butyl-5-[4-(2-phenylacetyl)piperazine-1-carbonyl]isoindole-1,3-dione |
| SMILES | CC(C)(C)N1C(=O)c2ccc(C(=O)N3CCN(C(=O)Cc4ccccc4)CC3)cc2C1=O |
| InChI | InChI=1S/C25H27N3O4/c1-25(2,3)28-23(31)19-10-9-18(16-20(19)24(28)32)22(30)27-13-11-26(12-14-27)21(29)15-17-7-5-4-6-8-17/h4-10,16H,11-15H2,1-3H3 |
| InChIKey | FBDSIZFAYLJDPT-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 78.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.51 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|