C19H20N2O4 — CID 108534758
1-[4-(3,5-dihydroxybenzoyl)piperazin-1-yl]-2-phenylethanone (PubChem CID 108534758) has the molecular formula C19H20N2O4 and a molecular weight of 340.38 g/mol. Its IUPAC name is 1-[4-(3,5-dihydroxybenzoyl)piperazin-1-yl]-2-phenylethanone.
| Compound Name | 1-[4-(3,5-dihydroxybenzoyl)piperazin-1-yl]-2-phenylethanone |
|---|---|
| PubChem CID | 108534758 |
| Molecular Formula | C19H20N2O4 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.14 |
| IUPAC Name | 1-[4-(3,5-dihydroxybenzoyl)piperazin-1-yl]-2-phenylethanone |
| SMILES | O=C(Cc1ccccc1)N1CCN(C(=O)c2cc(O)cc(O)c2)CC1 |
| InChI | InChI=1S/C19H20N2O4/c22-16-11-15(12-17(23)13-16)19(25)21-8-6-20(7-9-21)18(24)10-14-4-2-1-3-5-14/h1-5,11-13,22-23H,6-10H2 |
| InChIKey | XWTMYEWVLLAEFE-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 81.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |