C20H25N3O4 — CID 108564583
N-[1-(2-tert-butyl-1,3-dioxoisoindole-5-carbonyl)piperidin-4-yl]acetamide (PubChem CID 108564583) has the molecular formula C20H25N3O4 and a molecular weight of 371.44 g/mol. Its IUPAC name is N-[1-(2-tert-butyl-1,3-dioxoisoindole-5-carbonyl)piperidin-4-yl]acetamide.
| Compound Name | N-[1-(2-tert-butyl-1,3-dioxoisoindole-5-carbonyl)piperidin-4-yl]acetamide |
|---|---|
| PubChem CID | 108564583 |
| Molecular Formula | C20H25N3O4 |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.18 |
| IUPAC Name | N-[1-(2-tert-butyl-1,3-dioxoisoindole-5-carbonyl)piperidin-4-yl]acetamide |
| SMILES | CC(=O)NC1CCN(C(=O)c2ccc3c(c2)C(=O)N(C(C)(C)C)C3=O)CC1 |
| InChI | InChI=1S/C20H25N3O4/c1-12(24)21-14-7-9-22(10-8-14)17(25)13-5-6-15-16(11-13)19(27)23(18(15)26)20(2,3)4/h5-6,11,14H,7-10H2,1-4H3,(H,21,24) |
| InChIKey | WAAZEGHLHSZYMS-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|