C23H22FN3O5 — CID 46253372
ethyl 4-[5-[(2-fluorophenyl)carbamoyl]-1,3-dioxoisoindol-2-yl]piperidine-1-carboxylate (PubChem CID 46253372) has the molecular formula C23H22FN3O5 and a molecular weight of 439.44 g/mol. Its IUPAC name is ethyl 4-[5-[(2-fluorophenyl)carbamoyl]-1,3-dioxoisoindol-2-yl]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[5-[(2-fluorophenyl)carbamoyl]-1,3-dioxoisoindol-2-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 46253372 |
| Molecular Formula | C23H22FN3O5 |
| Molecular Weight | 439.44 g/mol |
| Exact Mass | 439.15 |
| IUPAC Name | ethyl 4-[5-[(2-fluorophenyl)carbamoyl]-1,3-dioxoisoindol-2-yl]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(N2C(=O)c3ccc(C(=O)Nc4ccccc4F)cc3C2=O)CC1 |
| InChI | InChI=1S/C23H22FN3O5/c1-2-32-23(31)26-11-9-15(10-12-26)27-21(29)16-8-7-14(13-17(16)22(27)30)20(28)25-19-6-4-3-5-18(19)24/h3-8,13,15H,2,9-12H2,1H3,(H,25,28) |
| InChIKey | DVKPYKAOUAQMPI-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.44 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|