C27H27N3O9 — CID 46253351
dimethyl 5-[[2-(1-ethoxycarbonylpiperidin-4-yl)-1,3-dioxoisoindole-5-carbonyl]amino]benzene-1,3-dicarboxylate (PubChem CID 46253351) has the molecular formula C27H27N3O9 and a molecular weight of 537.53 g/mol. Its IUPAC name is dimethyl 5-[[2-(1-ethoxycarbonylpiperidin-4-yl)-1,3-dioxoisoindole-5-carbonyl]amino]benzene-1,3-dicarboxylate.
| Compound Name | dimethyl 5-[[2-(1-ethoxycarbonylpiperidin-4-yl)-1,3-dioxoisoindole-5-carbonyl]amino]benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 46253351 |
| Molecular Formula | C27H27N3O9 |
| Molecular Weight | 537.53 g/mol |
| Exact Mass | 537.17 |
| IUPAC Name | dimethyl 5-[[2-(1-ethoxycarbonylpiperidin-4-yl)-1,3-dioxoisoindole-5-carbonyl]amino]benzene-1,3-dicarboxylate |
| SMILES | CCOC(=O)N1CCC(N2C(=O)c3ccc(C(=O)Nc4cc(C(=O)OC)cc(C(=O)OC)c4)cc3C2=O)CC1 |
| InChI | InChI=1S/C27H27N3O9/c1-4-39-27(36)29-9-7-19(8-10-29)30-23(32)20-6-5-15(14-21(20)24(30)33)22(31)28-18-12-16(25(34)37-2)11-17(13-18)26(35)38-3/h5-6,11-14,19H,4,7-10H2,1-3H3,(H,28,31) |
| InChIKey | YVGOHIHZLFLZGK-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 148.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.53 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|