C23H21N3O3 — CID 52806948
2-cyclopropyl-1,3-dioxo-N-(1-propylindol-5-yl)isoindole-5-carboxamide (PubChem CID 52806948) has the molecular formula C23H21N3O3 and a molecular weight of 387.44 g/mol. Its IUPAC name is 2-cyclopropyl-1,3-dioxo-N-(1-propylindol-5-yl)isoindole-5-carboxamide.
| Compound Name | 2-cyclopropyl-1,3-dioxo-N-(1-propylindol-5-yl)isoindole-5-carboxamide |
|---|---|
| PubChem CID | 52806948 |
| Molecular Formula | C23H21N3O3 |
| Molecular Weight | 387.44 g/mol |
| Exact Mass | 387.16 |
| IUPAC Name | 2-cyclopropyl-1,3-dioxo-N-(1-propylindol-5-yl)isoindole-5-carboxamide |
| SMILES | CCCn1ccc2cc(NC(=O)c3ccc4c(c3)C(=O)N(C3CC3)C4=O)ccc21 |
| InChI | InChI=1S/C23H21N3O3/c1-2-10-25-11-9-14-12-16(4-8-20(14)25)24-21(27)15-3-7-18-19(13-15)23(29)26(22(18)28)17-5-6-17/h3-4,7-9,11-13,17H,2,5-6,10H2,1H3,(H,24,27) |
| InChIKey | MZFVAVYSUDCEIT-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 71.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.44 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|