C19H27N3O2 — CID 111424917
4-(1-hydroxyethyl)-N-(1-propylindol-5-yl)piperidine-1-carboxamide (PubChem CID 111424917) has the molecular formula C19H27N3O2 and a molecular weight of 329.44 g/mol. Its IUPAC name is 4-(1-hydroxyethyl)-N-(1-propylindol-5-yl)piperidine-1-carboxamide.
| Compound Name | 4-(1-hydroxyethyl)-N-(1-propylindol-5-yl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 111424917 |
| Molecular Formula | C19H27N3O2 |
| Molecular Weight | 329.44 g/mol |
| Exact Mass | 329.21 |
| IUPAC Name | 4-(1-hydroxyethyl)-N-(1-propylindol-5-yl)piperidine-1-carboxamide |
| SMILES | CCCn1ccc2cc(NC(=O)N3CCC(C(C)O)CC3)ccc21 |
| InChI | InChI=1S/C19H27N3O2/c1-3-9-21-10-8-16-13-17(4-5-18(16)21)20-19(24)22-11-6-15(7-12-22)14(2)23/h4-5,8,10,13-15,23H,3,6-7,9,11-12H2,1-2H3,(H,20,24) |
| InChIKey | ZZIYLZFTNFMLFC-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 57.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.44 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |