C17H23N3O3S — CID 125141718
(3S)-3-methylsulfonyl-N-(1-propylindol-6-yl)pyrrolidine-1-carboxamide (PubChem CID 125141718) has the molecular formula C17H23N3O3S and a molecular weight of 349.46 g/mol. Its IUPAC name is (3S)-3-methylsulfonyl-N-(1-propylindol-6-yl)pyrrolidine-1-carboxamide.
| Compound Name | (3S)-3-methylsulfonyl-N-(1-propylindol-6-yl)pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 125141718 |
| Molecular Formula | C17H23N3O3S |
| Molecular Weight | 349.46 g/mol |
| Exact Mass | 349.15 |
| IUPAC Name | (3S)-3-methylsulfonyl-N-(1-propylindol-6-yl)pyrrolidine-1-carboxamide |
| SMILES | CCCn1ccc2ccc(NC(=O)N3CC[C@H](S(C)(=O)=O)C3)cc21 |
| InChI | InChI=1S/C17H23N3O3S/c1-3-8-19-9-6-13-4-5-14(11-16(13)19)18-17(21)20-10-7-15(12-20)24(2,22)23/h4-6,9,11,15H,3,7-8,10,12H2,1-2H3,(H,18,21)/t15-/m0/s1 |
| InChIKey | XEJGTDPLGVUBKY-HNNXBMFYSA-N |
| XLogP | 2.70 |
| TPSA | 71.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.46 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |