C13H17ClN2O3S2 — CID 122159559
N-(3-chloro-4-methylsulfanylphenyl)-3-methylsulfonylpyrrolidine-1-carboxamide (PubChem CID 122159559) has the molecular formula C13H17ClN2O3S2 and a molecular weight of 348.88 g/mol. Its IUPAC name is N-(3-chloro-4-methylsulfanylphenyl)-3-methylsulfonylpyrrolidine-1-carboxamide.
| Compound Name | N-(3-chloro-4-methylsulfanylphenyl)-3-methylsulfonylpyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 122159559 |
| Molecular Formula | C13H17ClN2O3S2 |
| Molecular Weight | 348.88 g/mol |
| Exact Mass | 348.04 |
| IUPAC Name | N-(3-chloro-4-methylsulfanylphenyl)-3-methylsulfonylpyrrolidine-1-carboxamide |
| SMILES | CSc1ccc(NC(=O)N2CCC(S(C)(=O)=O)C2)cc1Cl |
| InChI | InChI=1S/C13H17ClN2O3S2/c1-20-12-4-3-9(7-11(12)14)15-13(17)16-6-5-10(8-16)21(2,18)19/h3-4,7,10H,5-6,8H2,1-2H3,(H,15,17) |
| InChIKey | ZWVDFUJRWNNOHH-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.88 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |