C14H18N2OS — CID 49498410
2-methylsulfanyl-N-(1-propylindol-5-yl)acetamide (PubChem CID 49498410) has the molecular formula C14H18N2OS and a molecular weight of 262.38 g/mol. Its IUPAC name is 2-methylsulfanyl-N-(1-propylindol-5-yl)acetamide.
| Compound Name | 2-methylsulfanyl-N-(1-propylindol-5-yl)acetamide |
|---|---|
| PubChem CID | 49498410 |
| Molecular Formula | C14H18N2OS |
| Molecular Weight | 262.38 g/mol |
| Exact Mass | 262.11 |
| IUPAC Name | 2-methylsulfanyl-N-(1-propylindol-5-yl)acetamide |
| SMILES | CCCn1ccc2cc(NC(=O)CSC)ccc21 |
| InChI | InChI=1S/C14H18N2OS/c1-3-7-16-8-6-11-9-12(4-5-13(11)16)15-14(17)10-18-2/h4-6,8-9H,3,7,10H2,1-2H3,(H,15,17) |
| InChIKey | ZNGJOZBDJSBLMH-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.38 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |