C17H22N4O2 — CID 71934971
2-(2-oxo-1,3-diazinan-1-yl)-N-(1-propylindol-5-yl)acetamide (PubChem CID 71934971) has the molecular formula C17H22N4O2 and a molecular weight of 314.39 g/mol. Its IUPAC name is 2-(2-oxo-1,3-diazinan-1-yl)-N-(1-propylindol-5-yl)acetamide.
| Compound Name | 2-(2-oxo-1,3-diazinan-1-yl)-N-(1-propylindol-5-yl)acetamide |
|---|---|
| PubChem CID | 71934971 |
| Molecular Formula | C17H22N4O2 |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.17 |
| IUPAC Name | 2-(2-oxo-1,3-diazinan-1-yl)-N-(1-propylindol-5-yl)acetamide |
| SMILES | CCCn1ccc2cc(NC(=O)CN3CCCNC3=O)ccc21 |
| InChI | InChI=1S/C17H22N4O2/c1-2-8-20-10-6-13-11-14(4-5-15(13)20)19-16(22)12-21-9-3-7-18-17(21)23/h4-6,10-11H,2-3,7-9,12H2,1H3,(H,18,23)(H,19,22) |
| InChIKey | GLCDOTWUGKHQKX-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 66.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |