C15H18N4O2 — CID 136526633
N-(1-methylindol-6-yl)-2-(2-oxo-1,3-diazinan-1-yl)acetamide (PubChem CID 136526633) has the molecular formula C15H18N4O2 and a molecular weight of 286.33 g/mol. Its IUPAC name is N-(1-methylindol-6-yl)-2-(2-oxo-1,3-diazinan-1-yl)acetamide.
| Compound Name | N-(1-methylindol-6-yl)-2-(2-oxo-1,3-diazinan-1-yl)acetamide |
|---|---|
| PubChem CID | 136526633 |
| Molecular Formula | C15H18N4O2 |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.14 |
| IUPAC Name | N-(1-methylindol-6-yl)-2-(2-oxo-1,3-diazinan-1-yl)acetamide |
| SMILES | Cn1ccc2ccc(NC(=O)CN3CCCNC3=O)cc21 |
| InChI | InChI=1S/C15H18N4O2/c1-18-8-5-11-3-4-12(9-13(11)18)17-14(20)10-19-7-2-6-16-15(19)21/h3-5,8-9H,2,6-7,10H2,1H3,(H,16,21)(H,17,20) |
| InChIKey | NZFDZQGWVNQKPW-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 66.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.33 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |