C15H19N3O3 — CID 111490459
N-(3-hydroxy-2-methylpropyl)-N'-(1-methylindol-6-yl)oxamide (PubChem CID 111490459) has the molecular formula C15H19N3O3 and a molecular weight of 289.34 g/mol. Its IUPAC name is N-(3-hydroxy-2-methylpropyl)-N'-(1-methylindol-6-yl)oxamide.
| Compound Name | N-(3-hydroxy-2-methylpropyl)-N'-(1-methylindol-6-yl)oxamide |
|---|---|
| PubChem CID | 111490459 |
| Molecular Formula | C15H19N3O3 |
| Molecular Weight | 289.34 g/mol |
| Exact Mass | 289.14 |
| IUPAC Name | N-(3-hydroxy-2-methylpropyl)-N'-(1-methylindol-6-yl)oxamide |
| SMILES | CC(CO)CNC(=O)C(=O)Nc1ccc2ccn(C)c2c1 |
| InChI | InChI=1S/C15H19N3O3/c1-10(9-19)8-16-14(20)15(21)17-12-4-3-11-5-6-18(2)13(11)7-12/h3-7,10,19H,8-9H2,1-2H3,(H,16,20)(H,17,21) |
| InChIKey | WDPQEHKCUNYSON-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 83.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.34 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|