C16H23N3O3 — CID 99820657
1-[3-hydroxy-2-(hydroxymethyl)-2-methylpropyl]-1-methyl-3-(1-methylindol-6-yl)urea (PubChem CID 99820657) has the molecular formula C16H23N3O3 and a molecular weight of 305.38 g/mol. Its IUPAC name is 1-[3-hydroxy-2-(hydroxymethyl)-2-methylpropyl]-1-methyl-3-(1-methylindol-6-yl)urea.
| Compound Name | 1-[3-hydroxy-2-(hydroxymethyl)-2-methylpropyl]-1-methyl-3-(1-methylindol-6-yl)urea |
|---|---|
| PubChem CID | 99820657 |
| Molecular Formula | C16H23N3O3 |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.17 |
| IUPAC Name | 1-[3-hydroxy-2-(hydroxymethyl)-2-methylpropyl]-1-methyl-3-(1-methylindol-6-yl)urea |
| SMILES | CN(CC(C)(CO)CO)C(=O)Nc1ccc2ccn(C)c2c1 |
| InChI | InChI=1S/C16H23N3O3/c1-16(10-20,11-21)9-19(3)15(22)17-13-5-4-12-6-7-18(2)14(12)8-13/h4-8,20-21H,9-11H2,1-3H3,(H,17,22) |
| InChIKey | ACLWIHKSWPERLL-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 77.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |