C16H24N2O3 — CID 47669792
N'-(2,6-diethylphenyl)-N-(3-hydroxy-2-methylpropyl)oxamide (PubChem CID 47669792) has the molecular formula C16H24N2O3 and a molecular weight of 292.38 g/mol. Its IUPAC name is N'-(2,6-diethylphenyl)-N-(3-hydroxy-2-methylpropyl)oxamide.
| Compound Name | N'-(2,6-diethylphenyl)-N-(3-hydroxy-2-methylpropyl)oxamide |
|---|---|
| PubChem CID | 47669792 |
| Molecular Formula | C16H24N2O3 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.18 |
| IUPAC Name | N'-(2,6-diethylphenyl)-N-(3-hydroxy-2-methylpropyl)oxamide |
| SMILES | CCc1cccc(CC)c1NC(=O)C(=O)NCC(C)CO |
| InChI | InChI=1S/C16H24N2O3/c1-4-12-7-6-8-13(5-2)14(12)18-16(21)15(20)17-9-11(3)10-19/h6-8,11,19H,4-5,9-10H2,1-3H3,(H,17,20)(H,18,21) |
| InChIKey | QTTNYHFDJMNZDH-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|