C14H17N3O2 — CID 43315674
N-(cyanomethyl)-N'-(2,6-diethylphenyl)oxamide (PubChem CID 43315674) has the molecular formula C14H17N3O2 and a molecular weight of 259.31 g/mol. Its IUPAC name is N-(cyanomethyl)-N'-(2,6-diethylphenyl)oxamide.
| Compound Name | N-(cyanomethyl)-N'-(2,6-diethylphenyl)oxamide |
|---|---|
| PubChem CID | 43315674 |
| Molecular Formula | C14H17N3O2 |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.13 |
| IUPAC Name | N-(cyanomethyl)-N'-(2,6-diethylphenyl)oxamide |
| SMILES | CCc1cccc(CC)c1NC(=O)C(=O)NCC#N |
| InChI | InChI=1S/C14H17N3O2/c1-3-10-6-5-7-11(4-2)12(10)17-14(19)13(18)16-9-8-15/h5-7H,3-4,9H2,1-2H3,(H,16,18)(H,17,19) |
| InChIKey | BZEOISNLOILKTB-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 81.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|