C16H24N2O3 — CID 108511574
N-(2,6-diethylphenyl)-N'-(1-hydroxy-2-methylpropan-2-yl)oxamide (PubChem CID 108511574) has the molecular formula C16H24N2O3 and a molecular weight of 292.38 g/mol. Its IUPAC name is N-(2,6-diethylphenyl)-N'-(1-hydroxy-2-methylpropan-2-yl)oxamide.
| Compound Name | N-(2,6-diethylphenyl)-N'-(1-hydroxy-2-methylpropan-2-yl)oxamide |
|---|---|
| PubChem CID | 108511574 |
| Molecular Formula | C16H24N2O3 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.18 |
| IUPAC Name | N-(2,6-diethylphenyl)-N'-(1-hydroxy-2-methylpropan-2-yl)oxamide |
| SMILES | CCc1cccc(CC)c1NC(=O)C(=O)NC(C)(C)CO |
| InChI | InChI=1S/C16H24N2O3/c1-5-11-8-7-9-12(6-2)13(11)17-14(20)15(21)18-16(3,4)10-19/h7-9,19H,5-6,10H2,1-4H3,(H,17,20)(H,18,21) |
| InChIKey | JZQFSZQCZORKOA-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|