C15H17N3O2S — CID 108511411
N-(2,6-diethylphenyl)-N'-(1,3-thiazol-2-yl)oxamide (PubChem CID 108511411) has the molecular formula C15H17N3O2S and a molecular weight of 303.39 g/mol. Its IUPAC name is N-(2,6-diethylphenyl)-N'-(1,3-thiazol-2-yl)oxamide.
| Compound Name | N-(2,6-diethylphenyl)-N'-(1,3-thiazol-2-yl)oxamide |
|---|---|
| PubChem CID | 108511411 |
| Molecular Formula | C15H17N3O2S |
| Molecular Weight | 303.39 g/mol |
| Exact Mass | 303.10 |
| IUPAC Name | N-(2,6-diethylphenyl)-N'-(1,3-thiazol-2-yl)oxamide |
| SMILES | CCc1cccc(CC)c1NC(=O)C(=O)Nc1nccs1 |
| InChI | InChI=1S/C15H17N3O2S/c1-3-10-6-5-7-11(4-2)12(10)17-13(19)14(20)18-15-16-8-9-21-15/h5-9H,3-4H2,1-2H3,(H,17,19)(H,16,18,20) |
| InChIKey | KPPSEVYIBXSFFH-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.39 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|