C13H12FN3O2S — CID 2266097
N-[2-(2-fluorophenyl)ethyl]-N'-(1,3-thiazol-2-yl)oxamide (PubChem CID 2266097) has the molecular formula C13H12FN3O2S and a molecular weight of 293.32 g/mol. Its IUPAC name is N-[2-(2-fluorophenyl)ethyl]-N'-(1,3-thiazol-2-yl)oxamide.
| Compound Name | N-[2-(2-fluorophenyl)ethyl]-N'-(1,3-thiazol-2-yl)oxamide |
|---|---|
| PubChem CID | 2266097 |
| Molecular Formula | C13H12FN3O2S |
| Molecular Weight | 293.32 g/mol |
| Exact Mass | 293.06 |
| IUPAC Name | N-[2-(2-fluorophenyl)ethyl]-N'-(1,3-thiazol-2-yl)oxamide |
| SMILES | O=C(NCCc1ccccc1F)C(=O)Nc1nccs1 |
| InChI | InChI=1S/C13H12FN3O2S/c14-10-4-2-1-3-9(10)5-6-15-11(18)12(19)17-13-16-7-8-20-13/h1-4,7-8H,5-6H2,(H,15,18)(H,16,17,19) |
| InChIKey | HNOMHKZEPHICMN-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.32 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|