C16H16FN3O2 — CID 108985083
N-[2-(2-fluorophenyl)ethyl]-N'-(pyridin-3-ylmethyl)oxamide (PubChem CID 108985083) has the molecular formula C16H16FN3O2 and a molecular weight of 301.32 g/mol. Its IUPAC name is N-[2-(2-fluorophenyl)ethyl]-N'-(pyridin-3-ylmethyl)oxamide.
| Compound Name | N-[2-(2-fluorophenyl)ethyl]-N'-(pyridin-3-ylmethyl)oxamide |
|---|---|
| PubChem CID | 108985083 |
| Molecular Formula | C16H16FN3O2 |
| Molecular Weight | 301.32 g/mol |
| Exact Mass | 301.12 |
| IUPAC Name | N-[2-(2-fluorophenyl)ethyl]-N'-(pyridin-3-ylmethyl)oxamide |
| SMILES | O=C(NCCc1ccccc1F)C(=O)NCc1cccnc1 |
| InChI | InChI=1S/C16H16FN3O2/c17-14-6-2-1-5-13(14)7-9-19-15(21)16(22)20-11-12-4-3-8-18-10-12/h1-6,8,10H,7,9,11H2,(H,19,21)(H,20,22) |
| InChIKey | QUSJGRFUXQEUKN-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.32 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|