C10H13N3O3 — CID 3136535
N-(2-hydroxyethyl)-N'-(pyridin-3-ylmethyl)oxamide (PubChem CID 3136535) has the molecular formula C10H13N3O3 and a molecular weight of 223.23 g/mol. Its IUPAC name is N-(2-hydroxyethyl)-N'-(pyridin-3-ylmethyl)oxamide.
| Compound Name | N-(2-hydroxyethyl)-N'-(pyridin-3-ylmethyl)oxamide |
|---|---|
| PubChem CID | 3136535 |
| Molecular Formula | C10H13N3O3 |
| Molecular Weight | 223.23 g/mol |
| Exact Mass | 223.10 |
| IUPAC Name | N-(2-hydroxyethyl)-N'-(pyridin-3-ylmethyl)oxamide |
| SMILES | O=C(NCCO)C(=O)NCc1cccnc1 |
| InChI | InChI=1S/C10H13N3O3/c14-5-4-12-9(15)10(16)13-7-8-2-1-3-11-6-8/h1-3,6,14H,4-5,7H2,(H,12,15)(H,13,16) |
| InChIKey | IXLQSGQIGWUJTJ-UHFFFAOYSA-N |
| XLogP | -1.19 |
| TPSA | 91.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.23 |
| LogP ≤ 5 | -1.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|