C22H27FN2O2 — CID 108985279
N'-[2,6-di(propan-2-yl)phenyl]-N-[2-(2-fluorophenyl)ethyl]oxamide (PubChem CID 108985279) has the molecular formula C22H27FN2O2 and a molecular weight of 370.47 g/mol. Its IUPAC name is N'-[2,6-di(propan-2-yl)phenyl]-N-[2-(2-fluorophenyl)ethyl]oxamide.
| Compound Name | N'-[2,6-di(propan-2-yl)phenyl]-N-[2-(2-fluorophenyl)ethyl]oxamide |
|---|---|
| PubChem CID | 108985279 |
| Molecular Formula | C22H27FN2O2 |
| Molecular Weight | 370.47 g/mol |
| Exact Mass | 370.21 |
| IUPAC Name | N'-[2,6-di(propan-2-yl)phenyl]-N-[2-(2-fluorophenyl)ethyl]oxamide |
| SMILES | CC(C)c1cccc(C(C)C)c1NC(=O)C(=O)NCCc1ccccc1F |
| InChI | InChI=1S/C22H27FN2O2/c1-14(2)17-9-7-10-18(15(3)4)20(17)25-22(27)21(26)24-13-12-16-8-5-6-11-19(16)23/h5-11,14-15H,12-13H2,1-4H3,(H,24,26)(H,25,27) |
| InChIKey | MAIIEQVCTPSGCK-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.47 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|