C23H29FN2O5 — CID 15945258
N-[2,6-di(propan-2-yl)phenyl]-2-[(2-fluorophenyl)methylamino]acetamide;oxalic acid (PubChem CID 15945258) has the molecular formula C23H29FN2O5 and a molecular weight of 432.49 g/mol. Its IUPAC name is N-[2,6-di(propan-2-yl)phenyl]-2-[(2-fluorophenyl)methylamino]acetamide;oxalic acid.
| Compound Name | N-[2,6-di(propan-2-yl)phenyl]-2-[(2-fluorophenyl)methylamino]acetamide;oxalic acid |
|---|---|
| PubChem CID | 15945258 |
| Molecular Formula | C23H29FN2O5 |
| Molecular Weight | 432.49 g/mol |
| Exact Mass | 432.21 |
| IUPAC Name | N-[2,6-di(propan-2-yl)phenyl]-2-[(2-fluorophenyl)methylamino]acetamide;oxalic acid |
| SMILES | CC(C)c1cccc(C(C)C)c1NC(=O)CNCc1ccccc1F.O=C(O)C(=O)O |
| InChI | InChI=1S/C21H27FN2O.C2H2O4/c1-14(2)17-9-7-10-18(15(3)4)21(17)24-20(25)13-23-12-16-8-5-6-11-19(16)22;3-1(4)2(5)6/h5-11,14-15,23H,12-13H2,1-4H3,(H,24,25);(H,3,4)(H,5,6) |
| InChIKey | JIFCANGPYNJGNY-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 115.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.49 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|