C21H27FN2O — CID 108997808
N-[2,6-di(propan-2-yl)phenyl]-2-[(4-fluorophenyl)methylamino]acetamide (PubChem CID 108997808) has the molecular formula C21H27FN2O and a molecular weight of 342.46 g/mol. Its IUPAC name is N-[2,6-di(propan-2-yl)phenyl]-2-[(4-fluorophenyl)methylamino]acetamide.
| Compound Name | N-[2,6-di(propan-2-yl)phenyl]-2-[(4-fluorophenyl)methylamino]acetamide |
|---|---|
| PubChem CID | 108997808 |
| Molecular Formula | C21H27FN2O |
| Molecular Weight | 342.46 g/mol |
| Exact Mass | 342.21 |
| IUPAC Name | N-[2,6-di(propan-2-yl)phenyl]-2-[(4-fluorophenyl)methylamino]acetamide |
| SMILES | CC(C)c1cccc(C(C)C)c1NC(=O)CNCc1ccc(F)cc1 |
| InChI | InChI=1S/C21H27FN2O/c1-14(2)18-6-5-7-19(15(3)4)21(18)24-20(25)13-23-12-16-8-10-17(22)11-9-16/h5-11,14-15,23H,12-13H2,1-4H3,(H,24,25) |
| InChIKey | FBJQYBADBMWHCD-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.46 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |