C22H29FN2O — CID 109021297
N-[2,6-di(propan-2-yl)phenyl]-3-[(4-fluorophenyl)methylamino]propanamide (PubChem CID 109021297) has the molecular formula C22H29FN2O and a molecular weight of 356.49 g/mol. Its IUPAC name is N-[2,6-di(propan-2-yl)phenyl]-3-[(4-fluorophenyl)methylamino]propanamide.
| Compound Name | N-[2,6-di(propan-2-yl)phenyl]-3-[(4-fluorophenyl)methylamino]propanamide |
|---|---|
| PubChem CID | 109021297 |
| Molecular Formula | C22H29FN2O |
| Molecular Weight | 356.49 g/mol |
| Exact Mass | 356.23 |
| IUPAC Name | N-[2,6-di(propan-2-yl)phenyl]-3-[(4-fluorophenyl)methylamino]propanamide |
| SMILES | CC(C)c1cccc(C(C)C)c1NC(=O)CCNCc1ccc(F)cc1 |
| InChI | InChI=1S/C22H29FN2O/c1-15(2)19-6-5-7-20(16(3)4)22(19)25-21(26)12-13-24-14-17-8-10-18(23)11-9-17/h5-11,15-16,24H,12-14H2,1-4H3,(H,25,26) |
| InChIKey | MQDYSAJFCUDSGK-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.49 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|