C23H33N3O — CID 19874958
2-[[4-(dimethylamino)phenyl]methylamino]-N-[2,6-di(propan-2-yl)phenyl]acetamide (PubChem CID 19874958) has the molecular formula C23H33N3O and a molecular weight of 367.54 g/mol. Its IUPAC name is 2-[[4-(dimethylamino)phenyl]methylamino]-N-[2,6-di(propan-2-yl)phenyl]acetamide.
| Compound Name | 2-[[4-(dimethylamino)phenyl]methylamino]-N-[2,6-di(propan-2-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 19874958 |
| Molecular Formula | C23H33N3O |
| Molecular Weight | 367.54 g/mol |
| Exact Mass | 367.26 |
| IUPAC Name | 2-[[4-(dimethylamino)phenyl]methylamino]-N-[2,6-di(propan-2-yl)phenyl]acetamide |
| SMILES | CC(C)c1cccc(C(C)C)c1NC(=O)CNCc1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C23H33N3O/c1-16(2)20-8-7-9-21(17(3)4)23(20)25-22(27)15-24-14-18-10-12-19(13-11-18)26(5)6/h7-13,16-17,24H,14-15H2,1-6H3,(H,25,27) |
| InChIKey | OWFSXIMOWHMZNU-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.54 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|