C18H21FN2O — CID 108997765
2-[(4-fluorophenyl)methylamino]-N-(4-propan-2-ylphenyl)acetamide (PubChem CID 108997765) has the molecular formula C18H21FN2O and a molecular weight of 300.38 g/mol. Its IUPAC name is 2-[(4-fluorophenyl)methylamino]-N-(4-propan-2-ylphenyl)acetamide.
| Compound Name | 2-[(4-fluorophenyl)methylamino]-N-(4-propan-2-ylphenyl)acetamide |
|---|---|
| PubChem CID | 108997765 |
| Molecular Formula | C18H21FN2O |
| Molecular Weight | 300.38 g/mol |
| Exact Mass | 300.16 |
| IUPAC Name | 2-[(4-fluorophenyl)methylamino]-N-(4-propan-2-ylphenyl)acetamide |
| SMILES | CC(C)c1ccc(NC(=O)CNCc2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C18H21FN2O/c1-13(2)15-5-9-17(10-6-15)21-18(22)12-20-11-14-3-7-16(19)8-4-14/h3-10,13,20H,11-12H2,1-2H3,(H,21,22) |
| InChIKey | RVPUNDIWQOEGPC-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.38 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |