C20H26N2O3 — CID 109003078
2-[(3,4-dimethoxyphenyl)methylamino]-N-(4-propan-2-ylphenyl)acetamide (PubChem CID 109003078) has the molecular formula C20H26N2O3 and a molecular weight of 342.44 g/mol. Its IUPAC name is 2-[(3,4-dimethoxyphenyl)methylamino]-N-(4-propan-2-ylphenyl)acetamide.
| Compound Name | 2-[(3,4-dimethoxyphenyl)methylamino]-N-(4-propan-2-ylphenyl)acetamide |
|---|---|
| PubChem CID | 109003078 |
| Molecular Formula | C20H26N2O3 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.19 |
| IUPAC Name | 2-[(3,4-dimethoxyphenyl)methylamino]-N-(4-propan-2-ylphenyl)acetamide |
| SMILES | COc1ccc(CNCC(=O)Nc2ccc(C(C)C)cc2)cc1OC |
| InChI | InChI=1S/C20H26N2O3/c1-14(2)16-6-8-17(9-7-16)22-20(23)13-21-12-15-5-10-18(24-3)19(11-15)25-4/h5-11,14,21H,12-13H2,1-4H3,(H,22,23) |
| InChIKey | JKGASKKVVGGAOC-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |