C14H14FN3O2S2 — CID 22868893
methyl (2S)-3-(2-fluorophenyl)-2-(1,3-thiazol-2-ylcarbamothioylamino)propanoate (PubChem CID 22868893) has the molecular formula C14H14FN3O2S2 and a molecular weight of 339.42 g/mol. Its IUPAC name is methyl (2S)-3-(2-fluorophenyl)-2-(1,3-thiazol-2-ylcarbamothioylamino)propanoate.
| Compound Name | methyl (2S)-3-(2-fluorophenyl)-2-(1,3-thiazol-2-ylcarbamothioylamino)propanoate |
|---|---|
| PubChem CID | 22868893 |
| Molecular Formula | C14H14FN3O2S2 |
| Molecular Weight | 339.42 g/mol |
| Exact Mass | 339.05 |
| IUPAC Name | methyl (2S)-3-(2-fluorophenyl)-2-(1,3-thiazol-2-ylcarbamothioylamino)propanoate |
| SMILES | COC(=O)[C@H](Cc1ccccc1F)NC(=S)Nc1nccs1 |
| InChI | InChI=1S/C14H14FN3O2S2/c1-20-12(19)11(8-9-4-2-3-5-10(9)15)17-13(21)18-14-16-6-7-22-14/h2-7,11H,8H2,1H3,(H2,16,17,18,21)/t11-/m0/s1 |
| InChIKey | FNRHDTUIPKXVPM-NSHDSACASA-N |
| XLogP | 2.35 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.42 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|