C14H21FNO3P — CID 57239408
methyl (2S)-2-[[1-deuterioethyl(ethyl)phosphoryl]amino]-3-(2-fluorophenyl)propanoate (PubChem CID 57239408) has the molecular formula C14H21FNO3P and a molecular weight of 302.30 g/mol. Its IUPAC name is methyl (2S)-2-[[1-deuterioethyl(ethyl)phosphoryl]amino]-3-(2-fluorophenyl)propanoate.
| Compound Name | methyl (2S)-2-[[1-deuterioethyl(ethyl)phosphoryl]amino]-3-(2-fluorophenyl)propanoate |
|---|---|
| PubChem CID | 57239408 |
| Molecular Formula | C14H21FNO3P |
| Molecular Weight | 302.30 g/mol |
| Exact Mass | 302.13 |
| IUPAC Name | methyl (2S)-2-[[1-deuterioethyl(ethyl)phosphoryl]amino]-3-(2-fluorophenyl)propanoate |
| SMILES | [2H]C(C)P(=O)(CC)N[C@@H](Cc1ccccc1F)C(=O)OC |
| InChI | InChI=1S/C14H21FNO3P/c1-4-20(18,5-2)16-13(14(17)19-3)10-11-8-6-7-9-12(11)15/h6-9,13H,4-5,10H2,1-3H3,(H,16,18)/t13-/m0/s1/i4D/t4?,13-,20? |
| InChIKey | NTHVDRZWJHCSPA-UXXVAYPSSA-N |
| XLogP | 2.82 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.30 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|