C12H9FN2O3S — CID 3407042
[2-oxo-2-(1,3-thiazol-2-ylamino)ethyl] 2-fluorobenzoate (PubChem CID 3407042) has the molecular formula C12H9FN2O3S and a molecular weight of 280.28 g/mol. Its IUPAC name is [2-oxo-2-(1,3-thiazol-2-ylamino)ethyl] 2-fluorobenzoate.
| Compound Name | [2-oxo-2-(1,3-thiazol-2-ylamino)ethyl] 2-fluorobenzoate |
|---|---|
| PubChem CID | 3407042 |
| Molecular Formula | C12H9FN2O3S |
| Molecular Weight | 280.28 g/mol |
| Exact Mass | 280.03 |
| IUPAC Name | [2-oxo-2-(1,3-thiazol-2-ylamino)ethyl] 2-fluorobenzoate |
| SMILES | O=C(COC(=O)c1ccccc1F)Nc1nccs1 |
| InChI | InChI=1S/C12H9FN2O3S/c13-9-4-2-1-3-8(9)11(17)18-7-10(16)15-12-14-5-6-19-12/h1-6H,7H2,(H,14,15,16) |
| InChIKey | CHIRNNWDCXLJQI-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.28 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |