C11H8ClN3O3S — CID 23999374
[2-oxo-2-(1,3-thiazol-2-ylamino)ethyl] 2-chloropyridine-3-carboxylate (PubChem CID 23999374) has the molecular formula C11H8ClN3O3S and a molecular weight of 297.72 g/mol. Its IUPAC name is [2-oxo-2-(1,3-thiazol-2-ylamino)ethyl] 2-chloropyridine-3-carboxylate.
| Compound Name | [2-oxo-2-(1,3-thiazol-2-ylamino)ethyl] 2-chloropyridine-3-carboxylate |
|---|---|
| PubChem CID | 23999374 |
| Molecular Formula | C11H8ClN3O3S |
| Molecular Weight | 297.72 g/mol |
| Exact Mass | 297.00 |
| IUPAC Name | [2-oxo-2-(1,3-thiazol-2-ylamino)ethyl] 2-chloropyridine-3-carboxylate |
| SMILES | O=C(COC(=O)c1cccnc1Cl)Nc1nccs1 |
| InChI | InChI=1S/C11H8ClN3O3S/c12-9-7(2-1-3-13-9)10(17)18-6-8(16)15-11-14-4-5-19-11/h1-5H,6H2,(H,14,15,16) |
| InChIKey | FBKNZOLGIIGFTJ-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.72 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|