C10H8N2O4S — CID 23745766
[2-oxo-2-(1,3-thiazol-2-ylamino)ethyl] furan-2-carboxylate (PubChem CID 23745766) has the molecular formula C10H8N2O4S and a molecular weight of 252.25 g/mol. Its IUPAC name is [2-oxo-2-(1,3-thiazol-2-ylamino)ethyl] furan-2-carboxylate.
| Compound Name | [2-oxo-2-(1,3-thiazol-2-ylamino)ethyl] furan-2-carboxylate |
|---|---|
| PubChem CID | 23745766 |
| Molecular Formula | C10H8N2O4S |
| Molecular Weight | 252.25 g/mol |
| Exact Mass | 252.02 |
| IUPAC Name | [2-oxo-2-(1,3-thiazol-2-ylamino)ethyl] furan-2-carboxylate |
| SMILES | O=C(COC(=O)c1ccco1)Nc1nccs1 |
| InChI | InChI=1S/C10H8N2O4S/c13-8(12-10-11-3-5-17-10)6-16-9(14)7-2-1-4-15-7/h1-5H,6H2,(H,11,12,13) |
| InChIKey | YEFBTZXMPPGJTC-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.25 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |