C12H11N3O3S — CID 5223064
[2-oxo-2-(1,3-thiazol-2-ylamino)ethyl] 2-aminobenzoate (PubChem CID 5223064) has the molecular formula C12H11N3O3S and a molecular weight of 277.31 g/mol. Its IUPAC name is [2-oxo-2-(1,3-thiazol-2-ylamino)ethyl] 2-aminobenzoate.
| Compound Name | [2-oxo-2-(1,3-thiazol-2-ylamino)ethyl] 2-aminobenzoate |
|---|---|
| PubChem CID | 5223064 |
| Molecular Formula | C12H11N3O3S |
| Molecular Weight | 277.31 g/mol |
| Exact Mass | 277.05 |
| IUPAC Name | [2-oxo-2-(1,3-thiazol-2-ylamino)ethyl] 2-aminobenzoate |
| SMILES | Nc1ccccc1C(=O)OCC(=O)Nc1nccs1 |
| InChI | InChI=1S/C12H11N3O3S/c13-9-4-2-1-3-8(9)11(17)18-7-10(16)15-12-14-5-6-19-12/h1-6H,7,13H2,(H,14,15,16) |
| InChIKey | OKSQIEKMQJYMNH-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 94.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.31 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|