C15H12ClN3O4 — CID 2515323
[2-(2-benzoylhydrazinyl)-2-oxoethyl] 2-chloropyridine-3-carboxylate (PubChem CID 2515323) has the molecular formula C15H12ClN3O4 and a molecular weight of 333.73 g/mol. Its IUPAC name is [2-(2-benzoylhydrazinyl)-2-oxoethyl] 2-chloropyridine-3-carboxylate.
| Compound Name | [2-(2-benzoylhydrazinyl)-2-oxoethyl] 2-chloropyridine-3-carboxylate |
|---|---|
| PubChem CID | 2515323 |
| Molecular Formula | C15H12ClN3O4 |
| Molecular Weight | 333.73 g/mol |
| Exact Mass | 333.05 |
| IUPAC Name | [2-(2-benzoylhydrazinyl)-2-oxoethyl] 2-chloropyridine-3-carboxylate |
| SMILES | O=C(COC(=O)c1cccnc1Cl)NNC(=O)c1ccccc1 |
| InChI | InChI=1S/C15H12ClN3O4/c16-13-11(7-4-8-17-13)15(22)23-9-12(20)18-19-14(21)10-5-2-1-3-6-10/h1-8H,9H2,(H,18,20)(H,19,21) |
| InChIKey | WBTCOHOIOHTKFX-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.73 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|