C16H23ClN2O3 — CID 47669715
N'-(3-chloro-2,6-diethylphenyl)-N-(3-hydroxy-2-methylpropyl)oxamide (PubChem CID 47669715) has the molecular formula C16H23ClN2O3 and a molecular weight of 326.82 g/mol. Its IUPAC name is N'-(3-chloro-2,6-diethylphenyl)-N-(3-hydroxy-2-methylpropyl)oxamide.
| Compound Name | N'-(3-chloro-2,6-diethylphenyl)-N-(3-hydroxy-2-methylpropyl)oxamide |
|---|---|
| PubChem CID | 47669715 |
| Molecular Formula | C16H23ClN2O3 |
| Molecular Weight | 326.82 g/mol |
| Exact Mass | 326.14 |
| IUPAC Name | N'-(3-chloro-2,6-diethylphenyl)-N-(3-hydroxy-2-methylpropyl)oxamide |
| SMILES | CCc1ccc(Cl)c(CC)c1NC(=O)C(=O)NCC(C)CO |
| InChI | InChI=1S/C16H23ClN2O3/c1-4-11-6-7-13(17)12(5-2)14(11)19-16(22)15(21)18-8-10(3)9-20/h6-7,10,20H,4-5,8-9H2,1-3H3,(H,18,21)(H,19,22) |
| InChIKey | CLHWGRBZRQOXFN-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.82 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|